C19H37IO3Si — CID 163238505
triethyl-[(1Z,4S,6S,7E)-1-iodo-6-(methoxymethoxy)-5,5-dimethylnona-1,7-dien-4-yl]oxysilane (PubChem CID 163238505) has the molecular formula C19H37IO3Si and a molecular weight of 468.49 g/mol. Its IUPAC name is triethyl-[(1Z,4S,6S,7E)-1-iodo-6-(methoxymethoxy)-5,5-dimethylnona-1,7-dien-4-yl]oxysilane.
| Compound Name | triethyl-[(1Z,4S,6S,7E)-1-iodo-6-(methoxymethoxy)-5,5-dimethylnona-1,7-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 163238505 |
| Molecular Formula | C19H37IO3Si |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | triethyl-[(1Z,4S,6S,7E)-1-iodo-6-(methoxymethoxy)-5,5-dimethylnona-1,7-dien-4-yl]oxysilane |
| SMILES | C/C=C/[C@H](OCOC)C(C)(C)[C@H](C/C=C\I)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H37IO3Si/c1-8-13-17(22-16-21-7)19(5,6)18(14-12-15-20)23-24(9-2,10-3)11-4/h8,12-13,15,17-18H,9-11,14,16H2,1-7H3/b13-8+,15-12-/t17-,18-/m0/s1 |
| InChIKey | SINRPCRJYAFAAZ-ZDQQDTBJSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|