About N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine
N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine (PubChem CID 163239171) has the molecular formula C23H51N3O
and a molecular weight of 385.68 g/mol. Its IUPAC name is N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine.
Molecular Properties
| Compound Name | N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine |
| PubChem CID | 163239171 |
| Molecular Formula | C23H51N3O |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.40 |
| IUPAC Name | N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine |
| SMILES | CCCN(CC)CC.CCN1CCC(C)(C)CC1.CCNCC1CC(O)C1 |
| InChI | InChI=1S/C9H19N.C7H15NO.C7H17N/c1-4-10-7-5-9(2,3)6-8-10;1-2-8-5-6-3-7(9)4-6;1-4-7-8(5-2)6-3/h4-8H2,1-3H3;6-9H,2-5H2,1H3;4-7H2,1-3H3 |
| InChIKey | ZNJADJJHHWSZAW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine?
The IUPAC name of N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine (CID 163239171) is N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine.
What is the SMILES notation for N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine?
The canonical SMILES for N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine is CCCN(CC)CC.CCN1CCC(C)(C)CC1.CCNCC1CC(O)C1.
What is the InChIKey of N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine?
The InChIKey is ZNJADJJHHWSZAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C7H15NO.C7H17N/c1-4-10-7-5-9(2,3)6-8-10;1-2-8-5-6-3-7(9)4-6;1-4-7-8(5-2)6-3/h4-8H2,1-3H3;6-9H,2-5H2,1H3;4-7H2,1-3H3.
What are the key properties of N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine?
N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine has a molecular weight of 385.68 g/mol, XLogP of 4.23, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpropan-1-amine;3-(ethylaminomethyl)cyclobutan-1-ol;1-ethyl-4,4-dimethylpiperidine is sourced from PubChem (CID 163239171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).