C26H28ClFN6O2 — CID 163239308
(1R,2S,3R,5R)-3-(4-amino-5-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methylamino]methyl]-1H-indol-6-yl]cyclopentane-1,2-diol (PubChem CID 163239308) has the molecular formula C26H28ClFN6O2 and a molecular weight of 511.00 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-amino-5-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methylamino]methyl]-1H-indol-6-yl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-amino-5-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methylamino]methyl]-1H-indol-6-yl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 163239308 |
| Molecular Formula | C26H28ClFN6O2 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-amino-5-chloropyrrolo[2,3-d]pyrimidin-7-yl)-5-[2-[[(3-fluoro-1-bicyclo[1.1.1]pentanyl)methylamino]methyl]-1H-indol-6-yl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1c(Cl)cn2[C@@H]1C[C@H](c2ccc3cc(CNCC45CC(F)(C4)C5)[nH]c3c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H28ClFN6O2/c27-17-7-34(24-20(17)23(29)31-12-32-24)19-5-16(21(35)22(19)36)13-1-2-14-3-15(33-18(14)4-13)6-30-11-25-8-26(28,9-25)10-25/h1-4,7,12,16,19,21-22,30,33,35-36H,5-6,8-11H2,(H2,29,31,32)/t16-,19-,21-,22+,25?,26?/m1/s1 |
| InChIKey | JYDDDMDGTVIUPW-INZZEXGYSA-N |
| XLogP | 3.58 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |