C9H7BrN4 — CID 163239695
12-bromo-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 163239695) has the molecular formula C9H7BrN4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 12-bromo-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 12-bromo-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 163239695 |
| Molecular Formula | C9H7BrN4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 12-bromo-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | Cn1cnc2cnc3[nH]cc(Br)c3c21 |
| InChI | InChI=1S/C9H7BrN4/c1-14-4-13-6-3-12-9-7(8(6)14)5(10)2-11-9/h2-4H,1H3,(H,11,12) |
| InChIKey | QVHVNEXISQYSRD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |