C16H16ClN — CID 163239944
8-chloro-5,11-dimethyl-6,11-dihydrobenzo[c][1]benzazepine (PubChem CID 163239944) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is 8-chloro-5,11-dimethyl-6,11-dihydrobenzo[c][1]benzazepine.
| Compound Name | 8-chloro-5,11-dimethyl-6,11-dihydrobenzo[c][1]benzazepine |
|---|---|
| PubChem CID | 163239944 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 8-chloro-5,11-dimethyl-6,11-dihydrobenzo[c][1]benzazepine |
| SMILES | CC1c2ccc(Cl)cc2CN(C)c2ccccc21 |
| InChI | InChI=1S/C16H16ClN/c1-11-14-8-7-13(17)9-12(14)10-18(2)16-6-4-3-5-15(11)16/h3-9,11H,10H2,1-2H3 |
| InChIKey | ZATOOXKMYYWYDD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |