C24H29F5O6SSi — CID 163240159
[2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] trifluoromethanesulfonate (PubChem CID 163240159) has the molecular formula C24H29F5O6SSi and a molecular weight of 568.63 g/mol. Its IUPAC name is [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] trifluoromethanesulfonate.
| Compound Name | [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 163240159 |
| Molecular Formula | C24H29F5O6SSi |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OCC1COC(C(F)(F)COS(=O)(=O)C(F)(F)F)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29F5O6SSi/c1-22(2,3)37(19-10-6-4-7-11-19,20-12-8-5-9-13-20)35-15-18-14-33-21(16-32-18)23(25,26)17-34-36(30,31)24(27,28)29/h4-13,18,21H,14-17H2,1-3H3 |
| InChIKey | NFGQXEMNDUXFPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|