C18H31N3O6S — CID 163240261
(3R,6S)-6-ethyl-3-(2-methylpropyl)-1-methylsulfonyl-8-(oxan-4-yl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione (PubChem CID 163240261) has the molecular formula C18H31N3O6S and a molecular weight of 417.53 g/mol. Its IUPAC name is (3R,6S)-6-ethyl-3-(2-methylpropyl)-1-methylsulfonyl-8-(oxan-4-yl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione.
| Compound Name | (3R,6S)-6-ethyl-3-(2-methylpropyl)-1-methylsulfonyl-8-(oxan-4-yl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
|---|---|
| PubChem CID | 163240261 |
| Molecular Formula | C18H31N3O6S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (3R,6S)-6-ethyl-3-(2-methylpropyl)-1-methylsulfonyl-8-(oxan-4-yl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
| SMILES | CC[C@H]1C(=O)N(C2CCOCC2)CC2N1C(=O)[C@@H](CC(C)C)ON2S(C)(=O)=O |
| InChI | InChI=1S/C18H31N3O6S/c1-5-14-17(22)19(13-6-8-26-9-7-13)11-16-20(14)18(23)15(10-12(2)3)27-21(16)28(4,24)25/h12-16H,5-11H2,1-4H3/t14-,15+,16?/m0/s1 |
| InChIKey | MRAXPNWHNJFZOT-QMRHZFGWSA-N |
| XLogP | 0.56 |
| TPSA | 96.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |