C38H47N5O5 — CID 163240331
(3R,6S)-6-(3-amino-3-oxopropyl)-3-benzyl-8-(3,3-diphenylpropyl)-N-hexyl-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide (PubChem CID 163240331) has the molecular formula C38H47N5O5 and a molecular weight of 653.82 g/mol. Its IUPAC name is (3R,6S)-6-(3-amino-3-oxopropyl)-3-benzyl-8-(3,3-diphenylpropyl)-N-hexyl-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide.
| Compound Name | (3R,6S)-6-(3-amino-3-oxopropyl)-3-benzyl-8-(3,3-diphenylpropyl)-N-hexyl-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
|---|---|
| PubChem CID | 163240331 |
| Molecular Formula | C38H47N5O5 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.36 |
| IUPAC Name | (3R,6S)-6-(3-amino-3-oxopropyl)-3-benzyl-8-(3,3-diphenylpropyl)-N-hexyl-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxamide |
| SMILES | CCCCCCNC(=O)N1O[C@H](Cc2ccccc2)C(=O)N2C1CN(CCC(c1ccccc1)c1ccccc1)C(=O)[C@@H]2CCC(N)=O |
| InChI | InChI=1S/C38H47N5O5/c1-2-3-4-14-24-40-38(47)43-35-27-41(25-23-31(29-17-10-6-11-18-29)30-19-12-7-13-20-30)36(45)32(21-22-34(39)44)42(35)37(46)33(48-43)26-28-15-8-5-9-16-28/h5-13,15-20,31-33,35H,2-4,14,21-27H2,1H3,(H2,39,44)(H,40,47)/t32-,33+,35?/m0/s1 |
| InChIKey | MEWPSYYPKFOLIN-KTQZDYDHSA-N |
| XLogP | 4.99 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|