C25H36N4O6 — CID 163240336
benzyl (3R,6S)-8-(3-amino-3-oxopropyl)-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate (PubChem CID 163240336) has the molecular formula C25H36N4O6 and a molecular weight of 488.59 g/mol. Its IUPAC name is benzyl (3R,6S)-8-(3-amino-3-oxopropyl)-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate.
| Compound Name | benzyl (3R,6S)-8-(3-amino-3-oxopropyl)-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
|---|---|
| PubChem CID | 163240336 |
| Molecular Formula | C25H36N4O6 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | benzyl (3R,6S)-8-(3-amino-3-oxopropyl)-3,6-bis(2-methylpropyl)-4,7-dioxo-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-1-carboxylate |
| SMILES | CC(C)C[C@H]1ON(C(=O)OCc2ccccc2)C2CN(CCC(N)=O)C(=O)[C@H](CC(C)C)N2C1=O |
| InChI | InChI=1S/C25H36N4O6/c1-16(2)12-19-23(31)27(11-10-21(26)30)14-22-28(19)24(32)20(13-17(3)4)35-29(22)25(33)34-15-18-8-6-5-7-9-18/h5-9,16-17,19-20,22H,10-15H2,1-4H3,(H2,26,30)/t19-,20+,22?/m0/s1 |
| InChIKey | BOHCGLYQRWQCAD-RJKSWSIASA-N |
| XLogP | 2.27 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |