C22H43N3O5 — CID 163240633
tert-butyl 4-[[(2S)-2-amino-4-methylpentanoyl]-(2,2-diethoxyethyl)amino]piperidine-1-carboxylate (PubChem CID 163240633) has the molecular formula C22H43N3O5 and a molecular weight of 429.60 g/mol. Its IUPAC name is tert-butyl 4-[[(2S)-2-amino-4-methylpentanoyl]-(2,2-diethoxyethyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2S)-2-amino-4-methylpentanoyl]-(2,2-diethoxyethyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163240633 |
| Molecular Formula | C22H43N3O5 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | tert-butyl 4-[[(2S)-2-amino-4-methylpentanoyl]-(2,2-diethoxyethyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(CN(C(=O)[C@@H](N)CC(C)C)C1CCN(C(=O)OC(C)(C)C)CC1)OCC |
| InChI | InChI=1S/C22H43N3O5/c1-8-28-19(29-9-2)15-25(20(26)18(23)14-16(3)4)17-10-12-24(13-11-17)21(27)30-22(5,6)7/h16-19H,8-15,23H2,1-7H3/t18-/m0/s1 |
| InChIKey | PAOATIAHGKSUMU-SFHVURJKSA-N |
| XLogP | 2.99 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|