C12H19NO — CID 163240839
(6Z)-1-amino-6-[(Z)-prop-1-enyl]nona-6,8-dien-3-one (PubChem CID 163240839) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (6Z)-1-amino-6-[(Z)-prop-1-enyl]nona-6,8-dien-3-one.
| Compound Name | (6Z)-1-amino-6-[(Z)-prop-1-enyl]nona-6,8-dien-3-one |
|---|---|
| PubChem CID | 163240839 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (6Z)-1-amino-6-[(Z)-prop-1-enyl]nona-6,8-dien-3-one |
| SMILES | C=C/C=C(\C=C/C)CCC(=O)CCN |
| InChI | InChI=1S/C12H19NO/c1-3-5-11(6-4-2)7-8-12(14)9-10-13/h3-6H,1,7-10,13H2,2H3/b6-4-,11-5+ |
| InChIKey | FJKQDKIOZNHNDG-NQTKGXIKSA-N |
| XLogP | 2.37 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|