About 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane
4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane (PubChem CID 163241122) has the molecular formula C16H26Cl2N2O3
and a molecular weight of 365.30 g/mol. Its IUPAC name is 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane.
Molecular Properties
| Compound Name | 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane |
| PubChem CID | 163241122 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane |
| SMILES | CC.CC.O=C1NC(c2c(O)ccc(Cl)c2Cl)CN1CCCO |
| InChI | InChI=1S/C12H14Cl2N2O3.2C2H6/c13-7-2-3-9(18)10(11(7)14)8-6-16(4-1-5-17)12(19)15-8;2*1-2/h2-3,8,17-18H,1,4-6H2,(H,15,19);2*1-2H3 |
| InChIKey | CJSUTMGLCRDXSF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane?
The IUPAC name of 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane (CID 163241122) is 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane.
What is the SMILES notation for 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane?
The canonical SMILES for 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane is CC.CC.O=C1NC(c2c(O)ccc(Cl)c2Cl)CN1CCCO.
What is the InChIKey of 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane?
The InChIKey is CJSUTMGLCRDXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2N2O3.2C2H6/c13-7-2-3-9(18)10(11(7)14)8-6-16(4-1-5-17)12(19)15-8;2*1-2/h2-3,8,17-18H,1,4-6H2,(H,15,19);2*1-2H3.
What are the key properties of 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane?
4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane has a molecular weight of 365.30 g/mol, XLogP of 4.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dichloro-6-hydroxyphenyl)-1-(3-hydroxypropyl)imidazolidin-2-one;ethane is sourced from PubChem (CID 163241122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).