About 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one
3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one (PubChem CID 163241157) has the molecular formula C14H18Cl2N2O2
and a molecular weight of 317.22 g/mol. Its IUPAC name is 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one |
| PubChem CID | 163241157 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one |
| SMILES | O=C1CCCN1C1CCNC1.Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H14N2O.C6H4Cl2O/c11-8-2-1-5-10(8)7-3-4-9-6-7;7-5-2-1-4(9)3-6(5)8/h7,9H,1-6H2;1-3,9H |
| InChIKey | BYATUPYLBYEDRN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one?
The IUPAC name of 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one (CID 163241157) is 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one.
What is the SMILES notation for 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one?
The canonical SMILES for 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one is O=C1CCCN1C1CCNC1.Oc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one?
The InChIKey is BYATUPYLBYEDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O.C6H4Cl2O/c11-8-2-1-5-10(8)7-3-4-9-6-7;7-5-2-1-4(9)3-6(5)8/h7,9H,1-6H2;1-3,9H.
What are the key properties of 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one?
3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one has a molecular weight of 317.22 g/mol, XLogP of 2.67, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichlorophenol;1-pyrrolidin-3-ylpyrrolidin-2-one is sourced from PubChem (CID 163241157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).