About (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one
(4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 163241160) has the molecular formula C14H13Cl2N3O2
and a molecular weight of 326.18 g/mol. Its IUPAC name is (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
| PubChem CID | 163241160 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cn1cc(N2C[C@H](c3c(O)ccc(Cl)c3Cl)CC2=O)cn1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c1-18-7-9(5-17-18)19-6-8(4-12(19)21)13-11(20)3-2-10(15)14(13)16/h2-3,5,7-8,20H,4,6H2,1H3/t8-/m1/s1 |
| InChIKey | ZJTRXUXCOLFXJO-MRVPVSSYSA-N |
| XLogP | 2.95 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one?
The IUPAC name of (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one (CID 163241160) is (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one.
What is the SMILES notation for (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one?
The canonical SMILES for (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one is Cn1cc(N2C[C@H](c3c(O)ccc(Cl)c3Cl)CC2=O)cn1.
What is the InChIKey of (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one?
The InChIKey is ZJTRXUXCOLFXJO-MRVPVSSYSA-N. The full InChI is InChI=1S/C14H13Cl2N3O2/c1-18-7-9(5-17-18)19-6-8(4-12(19)21)13-11(20)3-2-10(15)14(13)16/h2-3,5,7-8,20H,4,6H2,1H3/t8-/m1/s1.
What are the key properties of (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one?
(4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one has a molecular weight of 326.18 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(2,3-dichloro-6-hydroxyphenyl)-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one is sourced from PubChem (CID 163241160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).