C12H20N2 — CID 163241543
(3E,5E)-5-piperidin-1-ylhepta-1,3,5-trien-4-amine (PubChem CID 163241543) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (3E,5E)-5-piperidin-1-ylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-5-piperidin-1-ylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 163241543 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (3E,5E)-5-piperidin-1-ylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(=C/C)N1CCCCC1 |
| InChI | InChI=1S/C12H20N2/c1-3-8-11(13)12(4-2)14-9-6-5-7-10-14/h3-4,8H,1,5-7,9-10,13H2,2H3/b11-8+,12-4+ |
| InChIKey | BPOSBHZHVVHGTA-NELVGMAYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|