C16H29NO — CID 163241807
(7E,9Z)-8-amino-7-ethenyl-2-methylundeca-7,9-dien-3-one;ethane (PubChem CID 163241807) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (7E,9Z)-8-amino-7-ethenyl-2-methylundeca-7,9-dien-3-one;ethane.
| Compound Name | (7E,9Z)-8-amino-7-ethenyl-2-methylundeca-7,9-dien-3-one;ethane |
|---|---|
| PubChem CID | 163241807 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (7E,9Z)-8-amino-7-ethenyl-2-methylundeca-7,9-dien-3-one;ethane |
| SMILES | C=C/C(CCCC(=O)C(C)C)=C(N)\C=C/C.CC |
| InChI | InChI=1S/C14H23NO.C2H6/c1-5-8-13(15)12(6-2)9-7-10-14(16)11(3)4;1-2/h5-6,8,11H,2,7,9-10,15H2,1,3-4H3;1-2H3/b8-5-,13-12-; |
| InChIKey | KPUNOQQBGGYRRE-YYPHSILSSA-N |
| XLogP | 4.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|