C41H24Cl4F6N2O6 — CID 163242593
3,5-dichloro-N-[4-[4-[2-[4-[4-[(3,5-dichloro-2-hydroxybenzoyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-hydroxybenzamide (PubChem CID 163242593) has the molecular formula C41H24Cl4F6N2O6 and a molecular weight of 896.45 g/mol. Its IUPAC name is 3,5-dichloro-N-[4-[4-[2-[4-[4-[(3,5-dichloro-2-hydroxybenzoyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-hydroxybenzamide.
| Compound Name | 3,5-dichloro-N-[4-[4-[2-[4-[4-[(3,5-dichloro-2-hydroxybenzoyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 163242593 |
| Molecular Formula | C41H24Cl4F6N2O6 |
| Molecular Weight | 896.45 g/mol |
| Exact Mass | 894.03 |
| IUPAC Name | 3,5-dichloro-N-[4-[4-[2-[4-[4-[(3,5-dichloro-2-hydroxybenzoyl)amino]phenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(C(c3ccc(Oc4ccc(NC(=O)c5cc(Cl)cc(Cl)c5O)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C41H24Cl4F6N2O6/c42-23-17-31(35(54)33(44)19-23)37(56)52-25-5-13-29(14-6-25)58-27-9-1-21(2-10-27)39(40(46,47)48,41(49,50)51)22-3-11-28(12-4-22)59-30-15-7-26(8-16-30)53-38(57)32-18-24(43)20-34(45)36(32)55/h1-20,54-55H,(H,52,56)(H,53,57) |
| InChIKey | JDQDSNYRGRNSKG-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.45 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |