C27H33FN4O5S — CID 163242752
N-[4-(2,6-dimethylphenyl)-6-methoxypyrimidin-2-yl]-3-[[fluoro-[2-(oxan-4-yl)ethyl]amino]-hydroxymethyl]benzenesulfonamide (PubChem CID 163242752) has the molecular formula C27H33FN4O5S and a molecular weight of 544.65 g/mol. Its IUPAC name is N-[4-(2,6-dimethylphenyl)-6-methoxypyrimidin-2-yl]-3-[[fluoro-[2-(oxan-4-yl)ethyl]amino]-hydroxymethyl]benzenesulfonamide.
| Compound Name | N-[4-(2,6-dimethylphenyl)-6-methoxypyrimidin-2-yl]-3-[[fluoro-[2-(oxan-4-yl)ethyl]amino]-hydroxymethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 163242752 |
| Molecular Formula | C27H33FN4O5S |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | N-[4-(2,6-dimethylphenyl)-6-methoxypyrimidin-2-yl]-3-[[fluoro-[2-(oxan-4-yl)ethyl]amino]-hydroxymethyl]benzenesulfonamide |
| SMILES | COc1cc(-c2c(C)cccc2C)nc(NS(=O)(=O)c2cccc(C(O)N(F)CCC3CCOCC3)c2)n1 |
| InChI | InChI=1S/C27H33FN4O5S/c1-18-6-4-7-19(2)25(18)23-17-24(36-3)30-27(29-23)31-38(34,35)22-9-5-8-21(16-22)26(33)32(28)13-10-20-11-14-37-15-12-20/h4-9,16-17,20,26,33H,10-15H2,1-3H3,(H,29,30,31) |
| InChIKey | RFGGSCRFYLTXTM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|