About methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate
methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate (PubChem CID 163242863) has the molecular formula C20H17ClFN3O4S
and a molecular weight of 449.89 g/mol. Its IUPAC name is methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate |
| PubChem CID | 163242863 |
| Molecular Formula | C20H17ClFN3O4S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Nc2nc(Cl)c(F)c(-c3c(C)cccc3C)n2)c1 |
| InChI | InChI=1S/C20H17ClFN3O4S/c1-11-6-4-7-12(2)15(11)17-16(22)18(21)24-20(23-17)25-30(27,28)14-9-5-8-13(10-14)19(26)29-3/h4-10H,1-3H3,(H,23,24,25) |
| InChIKey | UZLVYQJVEPJSGQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate?
The IUPAC name of methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate (CID 163242863) is methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate.
What is the SMILES notation for methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate?
The canonical SMILES for methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate is COC(=O)c1cccc(S(=O)(=O)Nc2nc(Cl)c(F)c(-c3c(C)cccc3C)n2)c1.
What is the InChIKey of methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate?
The InChIKey is UZLVYQJVEPJSGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClFN3O4S/c1-11-6-4-7-12(2)15(11)17-16(22)18(21)24-20(23-17)25-30(27,28)14-9-5-8-13(10-14)19(26)29-3/h4-10H,1-3H3,(H,23,24,25).
What are the key properties of methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate?
methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate has a molecular weight of 449.89 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-fluoropyrimidin-2-yl]sulfamoyl]benzoate is sourced from PubChem (CID 163242863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).