C35H41N6O5S+ — CID 163242874
[3-(4-tert-butylphenyl)-3-[6-(2,6-dimethylphenyl)-2-[(3-methoxycarbonylphenyl)sulfonyl-(methoxymethyl)amino]pyrimidin-4-yl]propyl]imino-iminoazanium (PubChem CID 163242874) has the molecular formula C35H41N6O5S+ and a molecular weight of 657.82 g/mol. Its IUPAC name is [3-(4-tert-butylphenyl)-3-[6-(2,6-dimethylphenyl)-2-[(3-methoxycarbonylphenyl)sulfonyl-(methoxymethyl)amino]pyrimidin-4-yl]propyl]imino-iminoazanium.
| Compound Name | [3-(4-tert-butylphenyl)-3-[6-(2,6-dimethylphenyl)-2-[(3-methoxycarbonylphenyl)sulfonyl-(methoxymethyl)amino]pyrimidin-4-yl]propyl]imino-iminoazanium |
|---|---|
| PubChem CID | 163242874 |
| Molecular Formula | C35H41N6O5S+ |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | [3-(4-tert-butylphenyl)-3-[6-(2,6-dimethylphenyl)-2-[(3-methoxycarbonylphenyl)sulfonyl-(methoxymethyl)amino]pyrimidin-4-yl]propyl]imino-iminoazanium |
| SMILES | COCN(c1nc(-c2c(C)cccc2C)cc(C(CCN=[N+]=N)c2ccc(C(C)(C)C)cc2)n1)S(=O)(=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C35H41N6O5S/c1-23-10-8-11-24(2)32(23)31-21-30(29(18-19-37-40-36)25-14-16-27(17-15-25)35(3,4)5)38-34(39-31)41(22-45-6)47(43,44)28-13-9-12-26(20-28)33(42)46-7/h8-17,20-21,29,36H,18-19,22H2,1-7H3/q+1 |
| InChIKey | FWAPTCRWDJYNQZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|