About 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid
3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid (PubChem CID 163243037) has the molecular formula C20H15ClF3N3O4S
and a molecular weight of 485.87 g/mol. Its IUPAC name is 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid |
| PubChem CID | 163243037 |
| Molecular Formula | C20H15ClF3N3O4S |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid |
| SMILES | Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2cccc(C(=O)O)c2)nc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C20H15ClF3N3O4S/c1-10-5-3-6-11(2)14(10)16-15(20(22,23)24)17(21)26-19(25-16)27-32(30,31)13-8-4-7-12(9-13)18(28)29/h3-9H,1-2H3,(H,28,29)(H,25,26,27) |
| InChIKey | GDWCQTBZEHOMLB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid?
The IUPAC name of 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid (CID 163243037) is 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid.
What is the SMILES notation for 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid?
The canonical SMILES for 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid is Cc1cccc(C)c1-c1nc(NS(=O)(=O)c2cccc(C(=O)O)c2)nc(Cl)c1C(F)(F)F.
What is the InChIKey of 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid?
The InChIKey is GDWCQTBZEHOMLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClF3N3O4S/c1-10-5-3-6-11(2)14(10)16-15(20(22,23)24)17(21)26-19(25-16)27-32(30,31)13-8-4-7-12(9-13)18(28)29/h3-9H,1-2H3,(H,28,29)(H,25,26,27).
What are the key properties of 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid?
3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid has a molecular weight of 485.87 g/mol, XLogP of 4.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-(trifluoromethyl)pyrimidin-2-yl]sulfamoyl]benzoic acid is sourced from PubChem (CID 163243037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).