About (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol
(2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol (PubChem CID 163243127) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol.
Molecular Properties
| Compound Name | (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol |
| PubChem CID | 163243127 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol |
| SMILES | CC(C)(C)C[C@H](CO)NC1CC2(CC2)C1 |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)6-11(9-15)14-10-7-13(8-10)4-5-13/h10-11,14-15H,4-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | GUHGHSRJVJETAT-LLVKDONJSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol?
The IUPAC name of (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol (CID 163243127) is (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol.
What is the SMILES notation for (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol?
The canonical SMILES for (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol is CC(C)(C)C[C@H](CO)NC1CC2(CC2)C1.
What is the InChIKey of (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol?
The InChIKey is GUHGHSRJVJETAT-LLVKDONJSA-N. The full InChI is InChI=1S/C13H25NO/c1-12(2,3)6-11(9-15)14-10-7-13(8-10)4-5-13/h10-11,14-15H,4-9H2,1-3H3/t11-/m1/s1.
What are the key properties of (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol?
(2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol has a molecular weight of 211.35 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4,4-dimethyl-2-(spiro[2.3]hexan-5-ylamino)pentan-1-ol is sourced from PubChem (CID 163243127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).