C37H50N4O3S — CID 163243207
propan-2-yl N-[3-[2-[6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-7-methyl-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]ethyl]cyclobutyl]carbamate (PubChem CID 163243207) has the molecular formula C37H50N4O3S and a molecular weight of 630.90 g/mol. Its IUPAC name is propan-2-yl N-[3-[2-[6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-7-methyl-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]ethyl]cyclobutyl]carbamate.
| Compound Name | propan-2-yl N-[3-[2-[6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-7-methyl-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]ethyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 163243207 |
| Molecular Formula | C37H50N4O3S |
| Molecular Weight | 630.90 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | propan-2-yl N-[3-[2-[6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-7-methyl-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]ethyl]cyclobutyl]carbamate |
| SMILES | Cc1cccc(C)c1-c1nc2nc(c1C)OCC(CC(C)(C)C)C(CCC1CC(NC(=O)OC(C)C)C1)c1cccc(c1)SN2 |
| InChI | InChI=1S/C37H50N4O3S/c1-22(2)44-36(42)38-29-17-26(18-29)15-16-31-27-13-10-14-30(19-27)45-41-35-39-33(32-23(3)11-9-12-24(32)4)25(5)34(40-35)43-21-28(31)20-37(6,7)8/h9-14,19,22,26,28-29,31H,15-18,20-21H2,1-8H3,(H,38,42)(H,39,40,41) |
| InChIKey | BCJVDSYTDUKNBQ-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.90 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|