About 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid
5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid (PubChem CID 163243496) has the molecular formula C17H16ClN5O2S
and a molecular weight of 389.87 g/mol. Its IUPAC name is 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid |
| PubChem CID | 163243496 |
| Molecular Formula | C17H16ClN5O2S |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cc(C(=O)O)nn2C)n1 |
| InChI | InChI=1S/C17H16ClN5O2S/c1-9-5-4-6-10(2)15(9)11-7-13(18)20-17(19-11)22-26-14-8-12(16(24)25)21-23(14)3/h4-8H,1-3H3,(H,24,25)(H,19,20,22) |
| InChIKey | BOYXNZGMLIGWEV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid?
The IUPAC name of 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid (CID 163243496) is 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid is Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cc(C(=O)O)nn2C)n1.
What is the InChIKey of 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid?
The InChIKey is BOYXNZGMLIGWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN5O2S/c1-9-5-4-6-10(2)15(9)11-7-13(18)20-17(19-11)22-26-14-8-12(16(24)25)21-23(14)3/h4-8H,1-3H3,(H,24,25)(H,19,20,22).
What are the key properties of 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid?
5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid has a molecular weight of 389.87 g/mol, XLogP of 3.96, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanyl-1-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 163243496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).