C28H27F3N4OS — CID 163243617
(11R)-6-(2,6-dimethylphenyl)-11-methyl-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene;trifluoromethylbenzene (PubChem CID 163243617) has the molecular formula C28H27F3N4OS and a molecular weight of 524.61 g/mol. Its IUPAC name is (11R)-6-(2,6-dimethylphenyl)-11-methyl-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene;trifluoromethylbenzene.
| Compound Name | (11R)-6-(2,6-dimethylphenyl)-11-methyl-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene;trifluoromethylbenzene |
|---|---|
| PubChem CID | 163243617 |
| Molecular Formula | C28H27F3N4OS |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (11R)-6-(2,6-dimethylphenyl)-11-methyl-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene;trifluoromethylbenzene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)N[C@H](C)CO2.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C21H22N4OS.C7H5F3/c1-13-6-4-7-14(2)20(13)18-11-19-24-21(23-18)25-27-17-9-5-8-16(10-17)22-15(3)12-26-19;8-7(9,10)6-4-2-1-3-5-6/h4-11,15,22H,12H2,1-3H3,(H,23,24,25);1-5H/t15-;/m1./s1 |
| InChIKey | MSGAVALLOQUJEJ-XFULWGLBSA-N |
| XLogP | 7.78 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|