C25H29F3N4O3S — CID 163243628
3-[[4-(2-amino-4,4,4-trifluorobutoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane (PubChem CID 163243628) has the molecular formula C25H29F3N4O3S and a molecular weight of 522.59 g/mol. Its IUPAC name is 3-[[4-(2-amino-4,4,4-trifluorobutoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane.
| Compound Name | 3-[[4-(2-amino-4,4,4-trifluorobutoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane |
|---|---|
| PubChem CID | 163243628 |
| Molecular Formula | C25H29F3N4O3S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 3-[[4-(2-amino-4,4,4-trifluorobutoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane |
| SMILES | CC.Cc1cccc(C)c1-c1cc(OCC(N)CC(F)(F)F)nc(NSc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C23H23F3N4O3S.C2H6/c1-13-5-3-6-14(2)20(13)18-10-19(33-12-16(27)11-23(24,25)26)29-22(28-18)30-34-17-8-4-7-15(9-17)21(31)32;1-2/h3-10,16H,11-12,27H2,1-2H3,(H,31,32)(H,28,29,30);1-2H3 |
| InChIKey | MRLNAQWDCVDUTO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|