C16H23NS — CID 163243695
(1Z,3Z,5Z)-N-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)-5-methylhepta-1,3,5-trien-1-amine (PubChem CID 163243695) has the molecular formula C16H23NS and a molecular weight of 261.43 g/mol. Its IUPAC name is (1Z,3Z,5Z)-N-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)-5-methylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5Z)-N-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)-5-methylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 163243695 |
| Molecular Formula | C16H23NS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (1Z,3Z,5Z)-N-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)-5-methylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(C)\C=C/C=C\NC(C)SC1C=CC=CC1 |
| InChI | InChI=1S/C16H23NS/c1-4-14(2)10-8-9-13-17-15(3)18-16-11-6-5-7-12-16/h4-11,13,15-17H,12H2,1-3H3/b10-8-,13-9-,14-4- |
| InChIKey | PDIYWXBNULQPKF-UPFLDJOSSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|