C28H42N6O6SSi — CID 163243805
5-[[4-[(2R)-2-amino-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylic acid (PubChem CID 163243805) has the molecular formula C28H42N6O6SSi and a molecular weight of 618.83 g/mol. Its IUPAC name is 5-[[4-[(2R)-2-amino-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-[[4-[(2R)-2-amino-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 163243805 |
| Molecular Formula | C28H42N6O6SSi |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 5-[[4-[(2R)-2-amino-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylic acid |
| SMILES | Cc1cccc(C)c1-c1cc(OC[C@H](N)CC(C)C)nc(NS(=O)(=O)c2cc(C(=O)O)nn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C28H42N6O6SSi/c1-18(2)13-21(29)16-40-24-14-22(26-19(3)9-8-10-20(26)4)30-28(31-24)33-41(37,38)25-15-23(27(35)36)32-34(25)17-39-11-12-42(5,6)7/h8-10,14-15,18,21H,11-13,16-17,29H2,1-7H3,(H,35,36)(H,30,31,33)/t21-/m1/s1 |
| InChIKey | FOTVGHVCWRWFCN-OAQYLSRUSA-N |
| XLogP | 4.52 |
| TPSA | 171.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|