About 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol
1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol (PubChem CID 163243976) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol |
| PubChem CID | 163243976 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)COCC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO2/c1-12-7-11(13)9-14-8-10-5-3-2-4-6-10/h3,5-6,11-13H,2,4,7-9H2,1H3 |
| InChIKey | OBGJGVHSTLTBAH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol?
The IUPAC name of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol (CID 163243976) is 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol.
What is the SMILES notation for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol?
The canonical SMILES for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol is CNCC(O)COCC1=CCCC=C1.
What is the InChIKey of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol?
The InChIKey is OBGJGVHSTLTBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-12-7-11(13)9-14-8-10-5-3-2-4-6-10/h3,5-6,11-13H,2,4,7-9H2,1H3.
What are the key properties of 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol?
1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol has a molecular weight of 197.28 g/mol, XLogP of 0.86, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,5-dien-1-ylmethoxy)-3-(methylamino)propan-2-ol is sourced from PubChem (CID 163243976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).