About methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate
methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate (PubChem CID 163244106) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate |
| PubChem CID | 163244106 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate |
| SMILES | COC(=O)C1=CNCC(=O)N1 |
| InChI | InChI=1S/C6H8N2O3/c1-11-6(10)4-2-7-3-5(9)8-4/h2,7H,3H2,1H3,(H,8,9) |
| InChIKey | GNBYWQYHLQKOIZ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate?
The IUPAC name of methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate (CID 163244106) is methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate.
What is the SMILES notation for methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate?
The canonical SMILES for methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate is COC(=O)C1=CNCC(=O)N1.
What is the InChIKey of methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate?
The InChIKey is GNBYWQYHLQKOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-11-6(10)4-2-7-3-5(9)8-4/h2,7H,3H2,1H3,(H,8,9).
What are the key properties of methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate?
methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate has a molecular weight of 156.14 g/mol, XLogP of -1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-oxo-2,4-dihydro-1H-pyrazine-5-carboxylate is sourced from PubChem (CID 163244106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).