C39H47N3OS — CID 163244479
12-[(3-benzyl-3-methylcyclobutyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene (PubChem CID 163244479) has the molecular formula C39H47N3OS and a molecular weight of 605.89 g/mol. Its IUPAC name is 12-[(3-benzyl-3-methylcyclobutyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene.
| Compound Name | 12-[(3-benzyl-3-methylcyclobutyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 163244479 |
| Molecular Formula | C39H47N3OS |
| Molecular Weight | 605.89 g/mol |
| Exact Mass | 605.34 |
| IUPAC Name | 12-[(3-benzyl-3-methylcyclobutyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(CC1CC(C)(Cc3ccccc3)C1)C(CC(C)(C)C)CO2 |
| InChI | InChI=1S/C39H47N3OS/c1-26-12-10-13-27(2)36(26)34-20-35-41-37(40-34)42-44-32-17-11-16-30(19-32)33(31(25-43-35)24-38(3,4)5)18-29-22-39(6,23-29)21-28-14-8-7-9-15-28/h7-17,19-20,29,31,33H,18,21-25H2,1-6H3,(H,40,41,42) |
| InChIKey | ONIVCJSQQHWJLB-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.89 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|