About [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium
[3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium (PubChem CID 163244962) has the molecular formula C19H17ClN3O4S+
and a molecular weight of 418.88 g/mol. Its IUPAC name is [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium.
Molecular Properties
| Compound Name | [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium |
| PubChem CID | 163244962 |
| Molecular Formula | C19H17ClN3O4S+ |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc(NS(=O)(=O)c2cccc(C(=O)[OH2+])c2)n1 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-11-5-3-6-12(2)17(11)15-10-16(20)22-19(21-15)23-28(26,27)14-8-4-7-13(9-14)18(24)25/h3-10H,1-2H3,(H,24,25)(H,21,22,23)/p+1 |
| InChIKey | VZEOOSWDDBRJTF-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 111.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium?
The IUPAC name of [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium (CID 163244962) is [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium.
What is the SMILES notation for [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium?
The canonical SMILES for [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium is Cc1cccc(C)c1-c1cc(Cl)nc(NS(=O)(=O)c2cccc(C(=O)[OH2+])c2)n1.
What is the InChIKey of [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium?
The InChIKey is VZEOOSWDDBRJTF-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H16ClN3O4S/c1-11-5-3-6-12(2)17(11)15-10-16(20)22-19(21-15)23-28(26,27)14-8-4-7-13(9-14)18(24)25/h3-10H,1-2H3,(H,24,25)(H,21,22,23)/p+1.
What are the key properties of [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium?
[3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium has a molecular weight of 418.88 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]benzoyl]oxidanium is sourced from PubChem (CID 163244962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).