C34H45N5O3S — CID 163245409
propan-2-yl 4-[6-(2,6-dimethylphenyl)-11-(2-methylpropyl)-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 163245409) has the molecular formula C34H45N5O3S and a molecular weight of 603.83 g/mol. Its IUPAC name is propan-2-yl 4-[6-(2,6-dimethylphenyl)-11-(2-methylpropyl)-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[6-(2,6-dimethylphenyl)-11-(2-methylpropyl)-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 163245409 |
| Molecular Formula | C34H45N5O3S |
| Molecular Weight | 603.83 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | propan-2-yl 4-[6-(2,6-dimethylphenyl)-11-(2-methylpropyl)-9-oxa-2-thia-3,5,12,18-tetrazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaen-12-yl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)N(C1CN(C(=O)OC(C)C)C(C)(C)C1)C(CC(C)C)CO2 |
| InChI | InChI=1S/C34H45N5O3S/c1-21(2)15-26-20-41-30-17-29(31-23(5)11-9-12-24(31)6)35-32(36-30)37-43-28-14-10-13-25(16-28)39(26)27-18-34(7,8)38(19-27)33(40)42-22(3)4/h9-14,16-17,21-22,26-27H,15,18-20H2,1-8H3,(H,35,36,37) |
| InChIKey | OPXNBKJRSCXLKH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.83 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|