About N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate
N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate (PubChem CID 163246256) has the molecular formula C8H13N2NiO3S-
and a molecular weight of 275.96 g/mol. Its IUPAC name is N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate.
Molecular Properties
| Compound Name | N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate |
| PubChem CID | 163246256 |
| Molecular Formula | C8H13N2NiO3S- |
| Molecular Weight | 275.96 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate |
| SMILES | NCCNS(=O)(=O)c1[c-]cccc1.O.[Ni] |
| InChI | InChI=1S/C8H11N2O2S.Ni.H2O/c9-6-7-10-13(11,12)8-4-2-1-3-5-8;;/h1-4,10H,6-7,9H2;;1H2/q-1;; |
| InChIKey | DCIRNZCXWZQKSS-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.96 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate?
The IUPAC name of N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate (CID 163246256) is N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate.
What is the SMILES notation for N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate?
The canonical SMILES for N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate is NCCNS(=O)(=O)c1[c-]cccc1.O.[Ni].
What is the InChIKey of N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate?
The InChIKey is DCIRNZCXWZQKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2O2S.Ni.H2O/c9-6-7-10-13(11,12)8-4-2-1-3-5-8;;/h1-4,10H,6-7,9H2;;1H2/q-1;;.
What are the key properties of N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate?
N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate has a molecular weight of 275.96 g/mol, XLogP of -1.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)benzenesulfonamide;nickel;hydrate is sourced from PubChem (CID 163246256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).