About 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol
3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol (PubChem CID 163246463) has the molecular formula C20H20ClN3O2S
and a molecular weight of 401.92 g/mol. Its IUPAC name is 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol.
Molecular Properties
| Compound Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol |
| PubChem CID | 163246463 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol |
| SMILES | CO.Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cccc(C=O)c2)n1 |
| InChI | InChI=1S/C19H16ClN3OS.CH4O/c1-12-5-3-6-13(2)18(12)16-10-17(20)22-19(21-16)23-25-15-8-4-7-14(9-15)11-24;1-2/h3-11H,1-2H3,(H,21,22,23);2H,1H3 |
| InChIKey | YGYDUMGRYWCFAK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol?
The IUPAC name of 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol (CID 163246463) is 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol.
What is the SMILES notation for 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol?
The canonical SMILES for 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol is CO.Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cccc(C=O)c2)n1.
What is the InChIKey of 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol?
The InChIKey is YGYDUMGRYWCFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN3OS.CH4O/c1-12-5-3-6-13(2)18(12)16-10-17(20)22-19(21-16)23-25-15-8-4-7-14(9-15)11-24;1-2/h3-11H,1-2H3,(H,21,22,23);2H,1H3.
What are the key properties of 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol?
3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol has a molecular weight of 401.92 g/mol, XLogP of 4.95, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzaldehyde;methanol is sourced from PubChem (CID 163246463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).