C29H36N6O6S — CID 163246665
tert-butyl 6-[6-(2,6-dimethylphenyl)-2-[[N-hydroxy-3-(hydroxymethyl)anilino]sulfanylamino]pyrimidin-4-yl]oxy-3-oxo-1,4-diazepane-1-carboxylate (PubChem CID 163246665) has the molecular formula C29H36N6O6S and a molecular weight of 596.71 g/mol. Its IUPAC name is tert-butyl 6-[6-(2,6-dimethylphenyl)-2-[[N-hydroxy-3-(hydroxymethyl)anilino]sulfanylamino]pyrimidin-4-yl]oxy-3-oxo-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 6-[6-(2,6-dimethylphenyl)-2-[[N-hydroxy-3-(hydroxymethyl)anilino]sulfanylamino]pyrimidin-4-yl]oxy-3-oxo-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 163246665 |
| Molecular Formula | C29H36N6O6S |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | tert-butyl 6-[6-(2,6-dimethylphenyl)-2-[[N-hydroxy-3-(hydroxymethyl)anilino]sulfanylamino]pyrimidin-4-yl]oxy-3-oxo-1,4-diazepane-1-carboxylate |
| SMILES | Cc1cccc(C)c1-c1cc(OC2CNC(=O)CN(C(=O)OC(C)(C)C)C2)nc(NSN(O)c2cccc(CO)c2)n1 |
| InChI | InChI=1S/C29H36N6O6S/c1-18-8-6-9-19(2)26(18)23-13-25(32-27(31-23)33-42-35(39)21-11-7-10-20(12-21)17-36)40-22-14-30-24(37)16-34(15-22)28(38)41-29(3,4)5/h6-13,22,36,39H,14-17H2,1-5H3,(H,30,37)(H,31,32,33) |
| InChIKey | QDYCEPYUCYHENN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 149.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|