C29H29F5N6OS — CID 163246903
4-(2-methylphenyl)-6-[3-(1-methylpiperidin-3-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine (PubChem CID 163246903) has the molecular formula C29H29F5N6OS and a molecular weight of 604.65 g/mol. Its IUPAC name is 4-(2-methylphenyl)-6-[3-(1-methylpiperidin-3-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine.
| Compound Name | 4-(2-methylphenyl)-6-[3-(1-methylpiperidin-3-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163246903 |
| Molecular Formula | C29H29F5N6OS |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 4-(2-methylphenyl)-6-[3-(1-methylpiperidin-3-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine |
| SMILES | Cc1ccccc1-c1nc(NSc2cnn(C)c2)nc(Oc2cccc(C3CCCN(C)C3)c2)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H29F5N6OS/c1-18-8-4-5-12-23(18)25-24(28(30,31)29(32,33)34)26(37-27(36-25)38-42-22-15-35-40(3)17-22)41-21-11-6-9-19(14-21)20-10-7-13-39(2)16-20/h4-6,8-9,11-12,14-15,17,20H,7,10,13,16H2,1-3H3,(H,36,37,38) |
| InChIKey | SPIXATFDYUUCMX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|