C29H29F5N6O2S — CID 163247246
1-methyl-N-[4-(2-methylphenyl)-6-[4-(1-methylpiperidin-3-yl)phenoxy]-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]pyrazole-4-sulfinamide (PubChem CID 163247246) has the molecular formula C29H29F5N6O2S and a molecular weight of 620.65 g/mol. Its IUPAC name is 1-methyl-N-[4-(2-methylphenyl)-6-[4-(1-methylpiperidin-3-yl)phenoxy]-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]pyrazole-4-sulfinamide.
| Compound Name | 1-methyl-N-[4-(2-methylphenyl)-6-[4-(1-methylpiperidin-3-yl)phenoxy]-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]pyrazole-4-sulfinamide |
|---|---|
| PubChem CID | 163247246 |
| Molecular Formula | C29H29F5N6O2S |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | 1-methyl-N-[4-(2-methylphenyl)-6-[4-(1-methylpiperidin-3-yl)phenoxy]-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]pyrazole-4-sulfinamide |
| SMILES | Cc1ccccc1-c1nc(NS(=O)c2cnn(C)c2)nc(Oc2ccc(C3CCCN(C)C3)cc2)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H29F5N6O2S/c1-18-7-4-5-9-23(18)25-24(28(30,31)29(32,33)34)26(37-27(36-25)38-43(41)22-15-35-40(3)17-22)42-21-12-10-19(11-13-21)20-8-6-14-39(2)16-20/h4-5,7,9-13,15,17,20H,6,8,14,16H2,1-3H3,(H,36,37,38) |
| InChIKey | HUGSXWPLSLPQPS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|