C25H25N5S — CID 163247264
2-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(1-phenylcyclopropyl)pyrimidin-4-amine (PubChem CID 163247264) has the molecular formula C25H25N5S and a molecular weight of 427.58 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(1-phenylcyclopropyl)pyrimidin-4-amine.
| Compound Name | 2-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(1-phenylcyclopropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 163247264 |
| Molecular Formula | C25H25N5S |
| Molecular Weight | 427.58 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(1-phenylcyclopropyl)pyrimidin-4-amine |
| SMILES | Cc1cccc(C)c1-c1nc(NSc2cnn(C)c2)cc(C2(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C25H25N5S/c1-17-8-7-9-18(2)23(17)24-27-21(25(12-13-25)19-10-5-4-6-11-19)14-22(28-24)29-31-20-15-26-30(3)16-20/h4-11,14-16H,12-13H2,1-3H3,(H,27,28,29) |
| InChIKey | OBDRPGKWSQKPNK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|