C17H18ClN5O2S — CID 163247550
N-[4-chloro-5-ethyl-6-(2-methylphenyl)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 163247550) has the molecular formula C17H18ClN5O2S and a molecular weight of 391.88 g/mol. Its IUPAC name is N-[4-chloro-5-ethyl-6-(2-methylphenyl)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[4-chloro-5-ethyl-6-(2-methylphenyl)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 163247550 |
| Molecular Formula | C17H18ClN5O2S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[4-chloro-5-ethyl-6-(2-methylphenyl)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | CCc1c(Cl)nc(NS(=O)(=O)c2cnn(C)c2)nc1-c1ccccc1C |
| InChI | InChI=1S/C17H18ClN5O2S/c1-4-13-15(14-8-6-5-7-11(14)2)20-17(21-16(13)18)22-26(24,25)12-9-19-23(3)10-12/h5-10H,4H2,1-3H3,(H,20,21,22) |
| InChIKey | HWYUNVLBHWCYPN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |