C9H9Cl2F3N4 — CID 163247640
N'-[4,6-dichloro-5-(2,2,2-trifluoroethyl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 163247640) has the molecular formula C9H9Cl2F3N4 and a molecular weight of 301.10 g/mol. Its IUPAC name is N'-[4,6-dichloro-5-(2,2,2-trifluoroethyl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4,6-dichloro-5-(2,2,2-trifluoroethyl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 163247640 |
| Molecular Formula | C9H9Cl2F3N4 |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | N'-[4,6-dichloro-5-(2,2,2-trifluoroethyl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(Cl)c(CC(F)(F)F)c(Cl)n1 |
| InChI | InChI=1S/C9H9Cl2F3N4/c1-18(2)4-15-8-16-6(10)5(7(11)17-8)3-9(12,13)14/h4H,3H2,1-2H3/b15-4+ |
| InChIKey | QIPYCXNIFOFFJR-SYZQJQIISA-N |
| XLogP | 3.11 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|