C24H26N5O4PS — CID 163248104
N-[4-(2,6-dimethylphenyl)-6-(4-dimethylphosphorylphenoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 163248104) has the molecular formula C24H26N5O4PS and a molecular weight of 511.54 g/mol. Its IUPAC name is N-[4-(2,6-dimethylphenyl)-6-(4-dimethylphosphorylphenoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(2,6-dimethylphenyl)-6-(4-dimethylphosphorylphenoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 163248104 |
| Molecular Formula | C24H26N5O4PS |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[4-(2,6-dimethylphenyl)-6-(4-dimethylphosphorylphenoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2ccc(P(C)(C)=O)cc2)nc(NS(=O)(=O)c2cnn(C)c2)n1 |
| InChI | InChI=1S/C24H26N5O4PS/c1-16-7-6-8-17(2)23(16)21-13-22(33-18-9-11-19(12-10-18)34(4,5)30)27-24(26-21)28-35(31,32)20-14-25-29(3)15-20/h6-15H,1-5H3,(H,26,27,28) |
| InChIKey | HGMRDTKUXCPNJC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|