About 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane
4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane (PubChem CID 163248125) has the molecular formula C9H13Cl2F2N3
and a molecular weight of 272.13 g/mol. Its IUPAC name is 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane.
Molecular Properties
| Compound Name | 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane |
| PubChem CID | 163248125 |
| Molecular Formula | C9H13Cl2F2N3 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane |
| SMILES | CC.CCC(F)(F)c1c(Cl)nc(N)nc1Cl |
| InChI | InChI=1S/C7H7Cl2F2N3.C2H6/c1-2-7(10,11)3-4(8)13-6(12)14-5(3)9;1-2/h2H2,1H3,(H2,12,13,14);1-2H3 |
| InChIKey | DKSMTZRGBMHNDA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane?
The IUPAC name of 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane (CID 163248125) is 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane.
What is the SMILES notation for 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane?
The canonical SMILES for 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane is CC.CCC(F)(F)c1c(Cl)nc(N)nc1Cl.
What is the InChIKey of 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane?
The InChIKey is DKSMTZRGBMHNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2F2N3.C2H6/c1-2-7(10,11)3-4(8)13-6(12)14-5(3)9;1-2/h2H2,1H3,(H2,12,13,14);1-2H3.
What are the key properties of 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane?
4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane has a molecular weight of 272.13 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-5-(1,1-difluoropropyl)pyrimidin-2-amine;ethane is sourced from PubChem (CID 163248125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).