About 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine
5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine (PubChem CID 163248480) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine |
| PubChem CID | 163248480 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine |
| SMILES | CC/C=C(\C=C(C)C)C1=C(C)CCC(N)=N1 |
| InChI | InChI=1S/C14H22N2/c1-5-6-12(9-10(2)3)14-11(4)7-8-13(15)16-14/h6,9H,5,7-8H2,1-4H3,(H2,15,16)/b12-6+ |
| InChIKey | WAYHLOWUXQEZDM-WUXMJOGZSA-N |
| XLogP | 3.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine?
The IUPAC name of 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine (CID 163248480) is 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine.
What is the SMILES notation for 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine?
The canonical SMILES for 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine is CC/C=C(\C=C(C)C)C1=C(C)CCC(N)=N1.
What is the InChIKey of 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine?
The InChIKey is WAYHLOWUXQEZDM-WUXMJOGZSA-N. The full InChI is InChI=1S/C14H22N2/c1-5-6-12(9-10(2)3)14-11(4)7-8-13(15)16-14/h6,9H,5,7-8H2,1-4H3,(H2,15,16)/b12-6+.
What are the key properties of 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine?
5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine has a molecular weight of 218.34 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-[(4E)-2-methylhepta-2,4-dien-4-yl]-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 163248480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).