C32H31N7O5 — CID 163249261
6,7-dimethoxy-2-[2-[4-[5-[2-nitro-5-(pyridin-4-ylmethoxy)phenyl]tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 163249261) has the molecular formula C32H31N7O5 and a molecular weight of 593.64 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-[4-[5-[2-nitro-5-(pyridin-4-ylmethoxy)phenyl]tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[2-[4-[5-[2-nitro-5-(pyridin-4-ylmethoxy)phenyl]tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163249261 |
| Molecular Formula | C32H31N7O5 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 6,7-dimethoxy-2-[2-[4-[5-[2-nitro-5-(pyridin-4-ylmethoxy)phenyl]tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(-n3nnc(-c4cc(OCc5ccncc5)ccc4[N+](=O)[O-])n3)cc1)CC2 |
| InChI | InChI=1S/C32H31N7O5/c1-42-30-17-24-12-16-37(20-25(24)18-31(30)43-2)15-11-22-3-5-26(6-4-22)38-35-32(34-36-38)28-19-27(7-8-29(28)39(40)41)44-21-23-9-13-33-14-10-23/h3-10,13-14,17-19H,11-12,15-16,20-21H2,1-2H3 |
| InChIKey | GHDOPAXJQIHLJM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 130.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|