C31H29N7O5 — CID 163249313
6,7-dimethoxy-2-[2-[4-[5-(2-nitro-5-pyridin-3-yloxyphenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 163249313) has the molecular formula C31H29N7O5 and a molecular weight of 579.62 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[2-[4-[5-(2-nitro-5-pyridin-3-yloxyphenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[2-[4-[5-(2-nitro-5-pyridin-3-yloxyphenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163249313 |
| Molecular Formula | C31H29N7O5 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 6,7-dimethoxy-2-[2-[4-[5-(2-nitro-5-pyridin-3-yloxyphenyl)tetrazol-2-yl]phenyl]ethyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(-n3nnc(-c4cc(Oc5cccnc5)ccc4[N+](=O)[O-])n3)cc1)CC2 |
| InChI | InChI=1S/C31H29N7O5/c1-41-29-16-22-12-15-36(20-23(22)17-30(29)42-2)14-11-21-5-7-24(8-6-21)37-34-31(33-35-37)27-18-25(9-10-28(27)38(39)40)43-26-4-3-13-32-19-26/h3-10,13,16-19H,11-12,14-15,20H2,1-2H3 |
| InChIKey | DHHYKJHNGCRQLL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 130.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|