C19H18N4O2 — CID 163250015
2-[6-(1-ethoxyethenyl)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 163250015) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[6-(1-ethoxyethenyl)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[6-(1-ethoxyethenyl)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 163250015 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[6-(1-ethoxyethenyl)-1,5-naphthyridin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | C=C(OCC)c1ccc2nccc(-c3cc4c([nH]3)CCNC4=O)c2n1 |
| InChI | InChI=1S/C19H18N4O2/c1-3-25-11(2)14-4-5-16-18(23-14)12(6-8-20-16)17-10-13-15(22-17)7-9-21-19(13)24/h4-6,8,10,22H,2-3,7,9H2,1H3,(H,21,24) |
| InChIKey | TWIRTDBPBXCRFY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|