About 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione
5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione (PubChem CID 163250074) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione.
Molecular Properties
| Compound Name | 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione |
| PubChem CID | 163250074 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione |
| SMILES | O=C1CC(=O)C(C[C@H]2COCCO2)CN1 |
| InChI | InChI=1S/C10H15NO4/c12-9-4-10(13)11-5-7(9)3-8-6-14-1-2-15-8/h7-8H,1-6H2,(H,11,13)/t7?,8-/m0/s1 |
| InChIKey | PQLIMKPHRIJOGM-MQWKRIRWSA-N |
| XLogP | -0.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione?
The IUPAC name of 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione (CID 163250074) is 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione.
What is the SMILES notation for 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione?
The canonical SMILES for 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione is O=C1CC(=O)C(C[C@H]2COCCO2)CN1.
What is the InChIKey of 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione?
The InChIKey is PQLIMKPHRIJOGM-MQWKRIRWSA-N. The full InChI is InChI=1S/C10H15NO4/c12-9-4-10(13)11-5-7(9)3-8-6-14-1-2-15-8/h7-8H,1-6H2,(H,11,13)/t7?,8-/m0/s1.
What are the key properties of 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione?
5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione has a molecular weight of 213.23 g/mol, XLogP of -0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2S)-1,4-dioxan-2-yl]methyl]piperidine-2,4-dione is sourced from PubChem (CID 163250074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).