C12H10F2N2O4 — CID 163250275
5-[(5,6-difluoro-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 163250275) has the molecular formula C12H10F2N2O4 and a molecular weight of 284.22 g/mol. Its IUPAC name is 5-[(5,6-difluoro-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(5,6-difluoro-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 163250275 |
| Molecular Formula | C12H10F2N2O4 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-[(5,6-difluoro-3-pyridinyl)iminomethyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(/C=N/c2cnc(F)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H10F2N2O4/c1-12(2)19-10(17)7(11(18)20-12)5-15-6-3-8(13)9(14)16-4-6/h3-5,7H,1-2H3/b15-5+ |
| InChIKey | TWWWWIOLKIBTFM-PJQLUOCWSA-N |
| XLogP | 1.51 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|