About 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione
1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione (PubChem CID 163250719) has the molecular formula C6H6N3PS
and a molecular weight of 183.18 g/mol. Its IUPAC name is 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione.
Molecular Properties
| Compound Name | 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione |
| PubChem CID | 163250719 |
| Molecular Formula | C6H6N3PS |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione |
| SMILES | Pn1ncc2ccc(=S)[nH]c21 |
| InChI | InChI=1S/C6H6N3PS/c10-9-6-4(3-7-9)1-2-5(11)8-6/h1-3H,10H2,(H,8,11) |
| InChIKey | PXPNTVBQQSUQLY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione?
The IUPAC name of 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione (CID 163250719) is 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione.
What is the SMILES notation for 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione?
The canonical SMILES for 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione is Pn1ncc2ccc(=S)[nH]c21.
What is the InChIKey of 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione?
The InChIKey is PXPNTVBQQSUQLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N3PS/c10-9-6-4(3-7-9)1-2-5(11)8-6/h1-3H,10H2,(H,8,11).
What are the key properties of 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione?
1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione has a molecular weight of 183.18 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phosphanyl-7H-pyrazolo[5,4-b]pyridine-6-thione is sourced from PubChem (CID 163250719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).